savanarigo savanarigo

04-02-2020
Biology

contestada

List the five components that an ecosystem
must contain to survive indefinitely.

Respuesta :

jujuba2010 jujuba2010

04-02-2020

Answer: In order to survive, ecosystems need five basic components: energy, mineral nutrients, water, oxygen, and living organisms.

Explanation: google

Answer Link

Otras preguntas

PLZ HELP 55 POINTS Two quantities, x and y, are related proportionally such that 3x=2y . Which equation shows the same proportional relationship? A x/y=3/2 B x/

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

A monopolist's maximized rate of economic profits is $1500 per week. Its weekly output is 500 units, and at this output rate, the firm's marginal cost is

How do people use their bodies and voices to communicate different emotions? What do individual behaviors indicate about their feelings toward one another or th

what does the inverse of f(x)=2x-3 looks like on a graph

Because of higher gasoline prices, firms using gasoline intensively in the production or distribution of their goods have experienced:_______.

what is the Uds. form of the verb pensar in the present tense? A. Pienso B. Pensamos C. Piensa D. Piensan

Which expression is equal to (1+6i)−(7+3i) ?

Abica Roast Coffee Company produces Columbian coffee in batches of 6,000 pounds. The standard quantity of materials required in the process is 6,000 pounds, wh

What is the pH of a 0.24 M diethylamine solution? Kb = 8.6 x 10^-4