robemack7315 robemack7315

03-03-2022
Chemistry

contestada

Potential energy is what

Respuesta :

24holmesselmh 24holmesselmh

06-05-2022

Answer:

the energy possessed by a body by its value of its position relative to others, stresses within itself, electric charge, and other factors.

Explanation:

Answer Link

Otras preguntas

What three things are required for a fire to start?

Events A and B are mutually exclusive. Find the missing probability. P(A) = 1/4 P(B) = 13/20 P(A or B) = ? 4/5 1/2 9/10 3/8

Questions1 Explain why a solid expands when it is heated.2 Explain how the liquid in a thermometer changes so that it can be used tomeasure a temperature.3 Use

How to find average acceleration only using displacement and time?

used to measure mass

Elma wants to increase her reading comprehension. She reads quickly and accurately, but still sometimes misunderstands what she is reading. What skill should sh

Find the measure of c.

PLease answer !!! Find constants $A$ and $B$ such that \[\frac{x + 7}{x^2 - x - 2} = \frac{A}{x - 2} + \frac{B}{x + 1}\] for all $x$ such that $x\neq -1$ and $x

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

Sally invested some money at 15 % interest. Sally also invested $172 more than 3 times that amount at 14%. How much is invested at each rate if Sally receives $