judymajano12 judymajano12
  • 02-08-2022
  • Mathematics
contestada

Can someone explain the steps I’m confused

Can someone explain the steps Im confused class=

Respuesta :

jimrgrant1 jimrgrant1
  • 02-08-2022

Answer:

x = 8 ± [tex]\sqrt{10}[/tex]

Step-by-step explanation:

x² - 16x + 54 = 0 ( subtract 54 from both sides )

x² - 16x = - 54

to complete the square

add ( half the coefficient of the x- term )² to both sides

x² + 2(- 8)x + 64 = - 54 + 64

(x - 8)² = 10 ( take the square root of both sides )

x - 8 = ± [tex]\sqrt{10}[/tex] ( add 8 to both sides )

x = 8 ± [tex]\sqrt{10}[/tex]

then

x = 8 - [tex]\sqrt{10}[/tex] , x = 8 + [tex]\sqrt{10}[/tex]

Answer Link

Otras preguntas

2. A force of 156 N acts on a 7.3-kg bowling ball for 0.40 s. a. What is the bowling ball's change in momentum?
Need help with this math problem please
Rewrite standard form equation in graphing form and then sketch the graph p(x) =x^2- 10x +16 f(x)=x^2+ 3x-10 g(x)=x^2- 4x -2 h(x)=-4x^2+ 4x+8
What body systems do you use when playing the flute?
15 POINTS! WILL GIVE BRAILEST!Islam, Christianity, and Judaism all claim _______________ as a holy city. Nazareth Mesopotamia Jerusalem Bethlehem Mecc
cosec(6b+pi/8)=sec(2b-pi/8)​
A car rental company recommends a car that can go 304 miles on 192 gallons of gasoline. However, there are other vehicles available that can travel more miles p
You solve the equation S=lw+2wh for w. Which equation is correct?
What two kinds of elements join together to form an ionic compound?
Find the inverse of function A(x)=4x^1/5+5